C19H13ClN4O2S — CID 136919083
4-[(Z)-[[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]hydrazinylidene]methyl]benzene-1,3-diol (PubChem CID 136919083) has the molecular formula C19H13ClN4O2S and a molecular weight of 396.86 g/mol. Its IUPAC name is 4-[(Z)-[[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]hydrazinylidene]methyl]benzene-1,3-diol.
| Compound Name | 4-[(Z)-[[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]hydrazinylidene]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136919083 |
| Molecular Formula | C19H13ClN4O2S |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 4-[(Z)-[[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]hydrazinylidene]methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(/C=N\Nc2ncnc3scc(-c4ccc(Cl)cc4)c23)c(O)c1 |
| InChI | InChI=1S/C19H13ClN4O2S/c20-13-4-1-11(2-5-13)15-9-27-19-17(15)18(21-10-22-19)24-23-8-12-3-6-14(25)7-16(12)26/h1-10,25-26H,(H,21,22,24)/b23-8- |
| InChIKey | URHCUXLLYJOLFX-NYAPKIOYSA-N |
| XLogP | 4.87 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|