C23H16ClN5S — CID 3332290
N-[(2-chloro-8-methylquinolin-3-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 3332290) has the molecular formula C23H16ClN5S and a molecular weight of 429.94 g/mol. Its IUPAC name is N-[(2-chloro-8-methylquinolin-3-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(2-chloro-8-methylquinolin-3-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 3332290 |
| Molecular Formula | C23H16ClN5S |
| Molecular Weight | 429.94 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | N-[(2-chloro-8-methylquinolin-3-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cccc2cc(C=NNc3ncnc4scc(-c5ccccc5)c34)c(Cl)nc12 |
| InChI | InChI=1S/C23H16ClN5S/c1-14-6-5-9-16-10-17(21(24)28-20(14)16)11-27-29-22-19-18(15-7-3-2-4-8-15)12-30-23(19)26-13-25-22/h2-13H,1H3,(H,25,26,29) |
| InChIKey | UICQHTWMDRCNIF-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.94 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|