C25H22N6S — CID 146025539
N-[(E)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 146025539) has the molecular formula C25H22N6S and a molecular weight of 438.56 g/mol. Its IUPAC name is N-[(E)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(E)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146025539 |
| Molecular Formula | C25H22N6S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[(E)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1ccc(-c2csc3ncnc(N/N=C/c4c(C)nn(-c5ccccc5)c4C)c23)cc1 |
| InChI | InChI=1S/C25H22N6S/c1-16-9-11-19(12-10-16)22-14-32-25-23(22)24(26-15-27-25)29-28-13-21-17(2)30-31(18(21)3)20-7-5-4-6-8-20/h4-15H,1-3H3,(H,26,27,29)/b28-13+ |
| InChIKey | KCPOUOGTUWHVPU-XODNFHPESA-N |
| XLogP | 5.92 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|