C22H16Br2N6O2 — CID 135509570
4-bromo-2-[(E)-[[4-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]phthalazin-1-yl]hydrazinylidene]methyl]phenol (PubChem CID 135509570) has the molecular formula C22H16Br2N6O2 and a molecular weight of 556.22 g/mol. Its IUPAC name is 4-bromo-2-[(E)-[[4-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]phthalazin-1-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 4-bromo-2-[(E)-[[4-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]phthalazin-1-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135509570 |
| Molecular Formula | C22H16Br2N6O2 |
| Molecular Weight | 556.22 g/mol |
| Exact Mass | 553.97 |
| IUPAC Name | 4-bromo-2-[(E)-[[4-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]phthalazin-1-yl]hydrazinylidene]methyl]phenol |
| SMILES | Oc1ccc(Br)cc1/C=N/Nc1nnc(N/N=C/c2cc(Br)ccc2O)c2ccccc12 |
| InChI | InChI=1S/C22H16Br2N6O2/c23-15-5-7-19(31)13(9-15)11-25-27-21-17-3-1-2-4-18(17)22(30-29-21)28-26-12-14-10-16(24)6-8-20(14)32/h1-12,31-32H,(H,27,29)(H,28,30)/b25-11+,26-12+ |
| InChIKey | FAWNYOZYTXLRLT-KOZSXFMUSA-N |
| XLogP | 5.46 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.22 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|