C21H15BrN4O2 — CID 135822277
2-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-3-phenylquinazolin-4-one (PubChem CID 135822277) has the molecular formula C21H15BrN4O2 and a molecular weight of 435.28 g/mol. Its IUPAC name is 2-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-3-phenylquinazolin-4-one.
| Compound Name | 2-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 135822277 |
| Molecular Formula | C21H15BrN4O2 |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 2-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-3-phenylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(N/N=C/c2cc(Br)ccc2O)n1-c1ccccc1 |
| InChI | InChI=1S/C21H15BrN4O2/c22-15-10-11-19(27)14(12-15)13-23-25-21-24-18-9-5-4-8-17(18)20(28)26(21)16-6-2-1-3-7-16/h1-13,27H,(H,24,25)/b23-13+ |
| InChIKey | RJFUCHIDFFGHJM-YDZHTSKRSA-N |
| XLogP | 4.30 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|