C21H14Cl2N4O — CID 3640022
2-[2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-3-phenylquinazolin-4-one (PubChem CID 3640022) has the molecular formula C21H14Cl2N4O and a molecular weight of 409.28 g/mol. Its IUPAC name is 2-[2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-3-phenylquinazolin-4-one.
| Compound Name | 2-[2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 3640022 |
| Molecular Formula | C21H14Cl2N4O |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 2-[2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-3-phenylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(NN=Cc2ccc(Cl)c(Cl)c2)n1-c1ccccc1 |
| InChI | InChI=1S/C21H14Cl2N4O/c22-17-11-10-14(12-18(17)23)13-24-26-21-25-19-9-5-4-8-16(19)20(28)27(21)15-6-2-1-3-7-15/h1-13H,(H,25,26) |
| InChIKey | SAGGHBCPWAVATQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|