C15H11ClN4O2 — CID 4897068
2-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-3-hydroxyquinazolin-4-one (PubChem CID 4897068) has the molecular formula C15H11ClN4O2 and a molecular weight of 314.73 g/mol. Its IUPAC name is 2-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-3-hydroxyquinazolin-4-one.
| Compound Name | 2-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-3-hydroxyquinazolin-4-one |
|---|---|
| PubChem CID | 4897068 |
| Molecular Formula | C15H11ClN4O2 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-3-hydroxyquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(NN=Cc2ccccc2Cl)n1O |
| InChI | InChI=1S/C15H11ClN4O2/c16-12-7-3-1-5-10(12)9-17-19-15-18-13-8-4-2-6-11(13)14(21)20(15)22/h1-9,22H,(H,18,19) |
| InChIKey | TYIUJXMQKUTAJB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|