C19H19ClN4O — CID 23625621
3-butyl-2-[(2E)-2-[(2-chlorophenyl)methylidene]hydrazinyl]quinazolin-4-one (PubChem CID 23625621) has the molecular formula C19H19ClN4O and a molecular weight of 354.84 g/mol. Its IUPAC name is 3-butyl-2-[(2E)-2-[(2-chlorophenyl)methylidene]hydrazinyl]quinazolin-4-one.
| Compound Name | 3-butyl-2-[(2E)-2-[(2-chlorophenyl)methylidene]hydrazinyl]quinazolin-4-one |
|---|---|
| PubChem CID | 23625621 |
| Molecular Formula | C19H19ClN4O |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-butyl-2-[(2E)-2-[(2-chlorophenyl)methylidene]hydrazinyl]quinazolin-4-one |
| SMILES | CCCCn1c(N/N=C/c2ccccc2Cl)nc2ccccc2c1=O |
| InChI | InChI=1S/C19H19ClN4O/c1-2-3-12-24-18(25)15-9-5-7-11-17(15)22-19(24)23-21-13-14-8-4-6-10-16(14)20/h4-11,13H,2-3,12H2,1H3,(H,22,23)/b21-13+ |
| InChIKey | ZZQFBGQNMRSUND-FYJGNVAPSA-N |
| XLogP | 4.30 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|