C16H14N4O2 — CID 4888440
3-hydroxy-2-[2-(1-phenylethylidene)hydrazinyl]quinazolin-4-one (PubChem CID 4888440) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 3-hydroxy-2-[2-(1-phenylethylidene)hydrazinyl]quinazolin-4-one.
| Compound Name | 3-hydroxy-2-[2-(1-phenylethylidene)hydrazinyl]quinazolin-4-one |
|---|---|
| PubChem CID | 4888440 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-hydroxy-2-[2-(1-phenylethylidene)hydrazinyl]quinazolin-4-one |
| SMILES | CC(=NNc1nc2ccccc2c(=O)n1O)c1ccccc1 |
| InChI | InChI=1S/C16H14N4O2/c1-11(12-7-3-2-4-8-12)18-19-16-17-14-10-6-5-9-13(14)15(21)20(16)22/h2-10,22H,1H3,(H,17,19) |
| InChIKey | IRHSZJGQXHELRJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|