C24H22N4O — CID 8984212
3-(2,4-dimethylphenyl)-2-[(2Z)-2-(1-phenylethylidene)hydrazinyl]quinazolin-4-one (PubChem CID 8984212) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-2-[(2Z)-2-(1-phenylethylidene)hydrazinyl]quinazolin-4-one.
| Compound Name | 3-(2,4-dimethylphenyl)-2-[(2Z)-2-(1-phenylethylidene)hydrazinyl]quinazolin-4-one |
|---|---|
| PubChem CID | 8984212 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-2-[(2Z)-2-(1-phenylethylidene)hydrazinyl]quinazolin-4-one |
| SMILES | C/C(=N/Nc1nc2ccccc2c(=O)n1-c1ccc(C)cc1C)c1ccccc1 |
| InChI | InChI=1S/C24H22N4O/c1-16-13-14-22(17(2)15-16)28-23(29)20-11-7-8-12-21(20)25-24(28)27-26-18(3)19-9-5-4-6-10-19/h4-15H,1-3H3,(H,25,27)/b26-18- |
| InChIKey | DFAIETGYOPMDAQ-ITYLOYPMSA-N |
| XLogP | 4.84 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|