C22H22N6OS — CID 9397404
2-[(2Z)-2-[1-(5-amino-3-methyl-1,2-thiazol-4-yl)ethylidene]hydrazinyl]-3-(2,4-dimethylphenyl)quinazolin-4-one (PubChem CID 9397404) has the molecular formula C22H22N6OS and a molecular weight of 418.53 g/mol. Its IUPAC name is 2-[(2Z)-2-[1-(5-amino-3-methyl-1,2-thiazol-4-yl)ethylidene]hydrazinyl]-3-(2,4-dimethylphenyl)quinazolin-4-one.
| Compound Name | 2-[(2Z)-2-[1-(5-amino-3-methyl-1,2-thiazol-4-yl)ethylidene]hydrazinyl]-3-(2,4-dimethylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 9397404 |
| Molecular Formula | C22H22N6OS |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-[(2Z)-2-[1-(5-amino-3-methyl-1,2-thiazol-4-yl)ethylidene]hydrazinyl]-3-(2,4-dimethylphenyl)quinazolin-4-one |
| SMILES | C/C(=N/Nc1nc2ccccc2c(=O)n1-c1ccc(C)cc1C)c1c(C)nsc1N |
| InChI | InChI=1S/C22H22N6OS/c1-12-9-10-18(13(2)11-12)28-21(29)16-7-5-6-8-17(16)24-22(28)26-25-14(3)19-15(4)27-30-20(19)23/h5-11H,23H2,1-4H3,(H,24,26)/b25-14- |
| InChIKey | XJTAFSZPFMGPCN-QFEZKATASA-N |
| XLogP | 4.19 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|