C19H16Cl2N4O4 — CID 1414830
ethyl 2-[2-[2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-4-oxoquinazolin-3-yl]oxyacetate (PubChem CID 1414830) has the molecular formula C19H16Cl2N4O4 and a molecular weight of 435.27 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-4-oxoquinazolin-3-yl]oxyacetate.
| Compound Name | ethyl 2-[2-[2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-4-oxoquinazolin-3-yl]oxyacetate |
|---|---|
| PubChem CID | 1414830 |
| Molecular Formula | C19H16Cl2N4O4 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | ethyl 2-[2-[2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-4-oxoquinazolin-3-yl]oxyacetate |
| SMILES | CCOC(=O)COn1c(NN=Cc2ccc(Cl)c(Cl)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C19H16Cl2N4O4/c1-2-28-17(26)11-29-25-18(27)13-5-3-4-6-16(13)23-19(25)24-22-10-12-7-8-14(20)15(21)9-12/h3-10H,2,11H2,1H3,(H,23,24) |
| InChIKey | HCEKMONOIHDAND-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|