C28H22ClN3O6 — CID 126295637
ethyl 2-[2-chloro-4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetate (PubChem CID 126295637) has the molecular formula C28H22ClN3O6 and a molecular weight of 531.95 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126295637 |
| Molecular Formula | C28H22ClN3O6 |
| Molecular Weight | 531.95 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | ethyl 2-[2-chloro-4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)cc1Cl |
| InChI | InChI=1S/C28H22ClN3O6/c1-3-36-26(33)16-37-24-12-11-17(13-20(24)29)15-30-32-27(31-21-8-5-4-7-18(21)28(32)34)25-14-19-22(35-2)9-6-10-23(19)38-25/h4-15H,3,16H2,1-2H3 |
| InChIKey | GPCHXILWFWIUJV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 105.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.95 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|