C24H15Cl2N3O3 — CID 126290274
3-[(3,4-dichlorophenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126290274) has the molecular formula C24H15Cl2N3O3 and a molecular weight of 464.31 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[(3,4-dichlorophenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126290274 |
| Molecular Formula | C24H15Cl2N3O3 |
| Molecular Weight | 464.31 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | COc1cccc2oc(-c3nc4ccccc4c(=O)n3N=Cc3ccc(Cl)c(Cl)c3)cc12 |
| InChI | InChI=1S/C24H15Cl2N3O3/c1-31-20-7-4-8-21-16(20)12-22(32-21)23-28-19-6-3-2-5-15(19)24(30)29(23)27-13-14-9-10-17(25)18(26)11-14/h2-13H,1H3 |
| InChIKey | KVTPUWHGMBRCBU-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 69.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.31 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|