C33H27N3O5 — CID 126290327
3-[(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126290327) has the molecular formula C33H27N3O5 and a molecular weight of 545.60 g/mol. Its IUPAC name is 3-[(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126290327 |
| Molecular Formula | C33H27N3O5 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 3-[(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C33H27N3O5/c1-3-39-30-18-23(16-17-29(30)40-21-22-10-5-4-6-11-22)20-34-36-32(35-26-13-8-7-12-24(26)33(36)37)31-19-25-27(38-2)14-9-15-28(25)41-31/h4-20H,3,21H2,1-2H3 |
| InChIKey | TYQZRKZWVQUKBC-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 88.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|