C21H14Cl2N4O2 — CID 137060081
2-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-1-phenylquinazolin-4-one (PubChem CID 137060081) has the molecular formula C21H14Cl2N4O2 and a molecular weight of 425.28 g/mol. Its IUPAC name is 2-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-1-phenylquinazolin-4-one.
| Compound Name | 2-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-1-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 137060081 |
| Molecular Formula | C21H14Cl2N4O2 |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 2-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-1-phenylquinazolin-4-one |
| SMILES | O=c1nc(N/N=C\c2cc(Cl)cc(Cl)c2O)n(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C21H14Cl2N4O2/c22-14-10-13(19(28)17(23)11-14)12-24-26-21-25-20(29)16-8-4-5-9-18(16)27(21)15-6-2-1-3-7-15/h1-12,28H,(H,25,26,29)/b24-12- |
| InChIKey | HZNIHOYMWPKJIC-MSXFZWOLSA-N |
| XLogP | 4.84 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|