C22H14Cl3N3OS — CID 135892476
2,4-dichloro-6-[(Z)-[[4-(4-chlorophenyl)-5-phenyl-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 135892476) has the molecular formula C22H14Cl3N3OS and a molecular weight of 474.80 g/mol. Its IUPAC name is 2,4-dichloro-6-[(Z)-[[4-(4-chlorophenyl)-5-phenyl-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(Z)-[[4-(4-chlorophenyl)-5-phenyl-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135892476 |
| Molecular Formula | C22H14Cl3N3OS |
| Molecular Weight | 474.80 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | 2,4-dichloro-6-[(Z)-[[4-(4-chlorophenyl)-5-phenyl-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N\Nc1nc(-c2ccc(Cl)cc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C22H14Cl3N3OS/c23-16-8-6-13(7-9-16)19-21(14-4-2-1-3-5-14)30-22(27-19)28-26-12-15-10-17(24)11-18(25)20(15)29/h1-12,29H,(H,27,28)/b26-12- |
| InChIKey | MILGSYZECZAWSZ-ZRGSRPPYSA-N |
| XLogP | 7.59 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.80 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|