C30H25N3OS — CID 94848957
4-(4-methylphenyl)-5-phenyl-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 94848957) has the molecular formula C30H25N3OS and a molecular weight of 475.62 g/mol. Its IUPAC name is 4-(4-methylphenyl)-5-phenyl-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(4-methylphenyl)-5-phenyl-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 94848957 |
| Molecular Formula | C30H25N3OS |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 4-(4-methylphenyl)-5-phenyl-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(-c2nc(N/N=C\c3ccccc3OCc3ccccc3)sc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H25N3OS/c1-22-16-18-24(19-17-22)28-29(25-12-6-3-7-13-25)35-30(32-28)33-31-20-26-14-8-9-15-27(26)34-21-23-10-4-2-5-11-23/h2-20H,21H2,1H3,(H,32,33)/b31-20- |
| InChIKey | HOGCWLFERMUEGT-GTWSWNCMSA-N |
| XLogP | 7.81 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|