C23H18N4O2S — CID 94848941
4-(4-methylphenyl)-N-[(Z)-(2-nitrophenyl)methylideneamino]-5-phenyl-1,3-thiazol-2-amine (PubChem CID 94848941) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is 4-(4-methylphenyl)-N-[(Z)-(2-nitrophenyl)methylideneamino]-5-phenyl-1,3-thiazol-2-amine.
| Compound Name | 4-(4-methylphenyl)-N-[(Z)-(2-nitrophenyl)methylideneamino]-5-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 94848941 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 4-(4-methylphenyl)-N-[(Z)-(2-nitrophenyl)methylideneamino]-5-phenyl-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(-c2nc(N/N=C\c3ccccc3[N+](=O)[O-])sc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18N4O2S/c1-16-11-13-17(14-12-16)21-22(18-7-3-2-4-8-18)30-23(25-21)26-24-15-19-9-5-6-10-20(19)27(28)29/h2-15H,1H3,(H,25,26)/b24-15- |
| InChIKey | ZJZJOMDPJSCBRW-IWIPYMOSSA-N |
| XLogP | 6.14 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|