C24H19N3S — CID 73204472
N-(cinnamylideneamino)-4,5-diphenyl-1,3-thiazol-2-amine (PubChem CID 73204472) has the molecular formula C24H19N3S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-(cinnamylideneamino)-4,5-diphenyl-1,3-thiazol-2-amine.
| Compound Name | N-(cinnamylideneamino)-4,5-diphenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 73204472 |
| Molecular Formula | C24H19N3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-(cinnamylideneamino)-4,5-diphenyl-1,3-thiazol-2-amine |
| SMILES | C(=Cc1ccccc1)C=NNc1nc(-c2ccccc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C24H19N3S/c1-4-11-19(12-5-1)13-10-18-25-27-24-26-22(20-14-6-2-7-15-20)23(28-24)21-16-8-3-9-17-21/h1-18H,(H,26,27) |
| InChIKey | ZDILMTSZDBXYPU-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|