C14H10Cl3N3 — CID 3908635
3,5,6-trichloro-N-(cinnamylideneamino)pyridin-2-amine (PubChem CID 3908635) has the molecular formula C14H10Cl3N3 and a molecular weight of 326.61 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(cinnamylideneamino)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(cinnamylideneamino)pyridin-2-amine |
|---|---|
| PubChem CID | 3908635 |
| Molecular Formula | C14H10Cl3N3 |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 3,5,6-trichloro-N-(cinnamylideneamino)pyridin-2-amine |
| SMILES | Clc1cc(Cl)c(NN=CC=Cc2ccccc2)nc1Cl |
| InChI | InChI=1S/C14H10Cl3N3/c15-11-9-12(16)14(19-13(11)17)20-18-8-4-7-10-5-2-1-3-6-10/h1-9H,(H,19,20) |
| InChIKey | GENPPOVEFWHCPM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|