C13H11ClN4O — CID 3253197
5-chloro-4-(2-cinnamylidenehydrazinyl)-1H-pyridazin-6-one (PubChem CID 3253197) has the molecular formula C13H11ClN4O and a molecular weight of 274.71 g/mol. Its IUPAC name is 5-chloro-4-(2-cinnamylidenehydrazinyl)-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-(2-cinnamylidenehydrazinyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 3253197 |
| Molecular Formula | C13H11ClN4O |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 5-chloro-4-(2-cinnamylidenehydrazinyl)-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(NN=CC=Cc2ccccc2)c1Cl |
| InChI | InChI=1S/C13H11ClN4O/c14-12-11(9-16-18-13(12)19)17-15-8-4-7-10-5-2-1-3-6-10/h1-9H,(H2,17,18,19) |
| InChIKey | GAAJAKKWZSDRMV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|