C18H13Cl3N4O2 — CID 110340730
5-chloro-4-[(2E)-2-[[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1H-pyridazin-6-one (PubChem CID 110340730) has the molecular formula C18H13Cl3N4O2 and a molecular weight of 423.69 g/mol. Its IUPAC name is 5-chloro-4-[(2E)-2-[[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[(2E)-2-[[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 110340730 |
| Molecular Formula | C18H13Cl3N4O2 |
| Molecular Weight | 423.69 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | 5-chloro-4-[(2E)-2-[[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(N/N=C/c2cccc(OCc3c(Cl)cccc3Cl)c2)c1Cl |
| InChI | InChI=1S/C18H13Cl3N4O2/c19-14-5-2-6-15(20)13(14)10-27-12-4-1-3-11(7-12)8-22-24-16-9-23-25-18(26)17(16)21/h1-9H,10H2,(H2,24,25,26)/b22-8+ |
| InChIKey | MZOVFGJDNWOIFU-GZIVZEMBSA-N |
| XLogP | 4.76 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.69 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|