C20H18Cl2N4O3 — CID 112538073
5-chloro-4-[(2Z)-2-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-1H-pyridazin-6-one (PubChem CID 112538073) has the molecular formula C20H18Cl2N4O3 and a molecular weight of 433.30 g/mol. Its IUPAC name is 5-chloro-4-[(2Z)-2-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[(2Z)-2-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 112538073 |
| Molecular Formula | C20H18Cl2N4O3 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 5-chloro-4-[(2Z)-2-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-1H-pyridazin-6-one |
| SMILES | CCOc1cc(/C=N\Nc2cn[nH]c(=O)c2Cl)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C20H18Cl2N4O3/c1-2-28-18-9-13(10-23-25-16-11-24-26-20(27)19(16)22)7-8-17(18)29-12-14-5-3-4-6-15(14)21/h3-11H,2,12H2,1H3,(H2,25,26,27)/b23-10- |
| InChIKey | FYYPDNPKGJFEJU-RMORIDSASA-N |
| XLogP | 4.50 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|