C19H15ClN4O4 — CID 110341005
[4-[(E)-[(5-chloro-6-oxo-1H-pyridazin-4-yl)hydrazinylidene]methyl]-2-methoxyphenyl] benzoate (PubChem CID 110341005) has the molecular formula C19H15ClN4O4 and a molecular weight of 398.81 g/mol. Its IUPAC name is [4-[(E)-[(5-chloro-6-oxo-1H-pyridazin-4-yl)hydrazinylidene]methyl]-2-methoxyphenyl] benzoate.
| Compound Name | [4-[(E)-[(5-chloro-6-oxo-1H-pyridazin-4-yl)hydrazinylidene]methyl]-2-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 110341005 |
| Molecular Formula | C19H15ClN4O4 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | [4-[(E)-[(5-chloro-6-oxo-1H-pyridazin-4-yl)hydrazinylidene]methyl]-2-methoxyphenyl] benzoate |
| SMILES | COc1cc(/C=N/Nc2cn[nH]c(=O)c2Cl)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H15ClN4O4/c1-27-16-9-12(10-21-23-14-11-22-24-18(25)17(14)20)7-8-15(16)28-19(26)13-5-3-2-4-6-13/h2-11H,1H3,(H2,23,24,25)/b21-10+ |
| InChIKey | UTFFTBQWMBNIBD-UFFVCSGVSA-N |
| XLogP | 3.10 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|