C13H11ClN4O3 — CID 110337939
methyl 4-[(E)-[(5-chloro-6-oxo-1H-pyridazin-4-yl)hydrazinylidene]methyl]benzoate (PubChem CID 110337939) has the molecular formula C13H11ClN4O3 and a molecular weight of 306.71 g/mol. Its IUPAC name is methyl 4-[(E)-[(5-chloro-6-oxo-1H-pyridazin-4-yl)hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[(E)-[(5-chloro-6-oxo-1H-pyridazin-4-yl)hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 110337939 |
| Molecular Formula | C13H11ClN4O3 |
| Molecular Weight | 306.71 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | methyl 4-[(E)-[(5-chloro-6-oxo-1H-pyridazin-4-yl)hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/Nc2cn[nH]c(=O)c2Cl)cc1 |
| InChI | InChI=1S/C13H11ClN4O3/c1-21-13(20)9-4-2-8(3-5-9)6-15-17-10-7-16-18-12(19)11(10)14/h2-7H,1H3,(H2,17,18,19)/b15-6+ |
| InChIKey | YRMQOHQPHSHERJ-GIDUJCDVSA-N |
| XLogP | 1.66 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.71 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|