C14H13Cl3N4O2 — CID 110509805
5-chloro-4-[(2Z)-2-[(3,5-dichloro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one (PubChem CID 110509805) has the molecular formula C14H13Cl3N4O2 and a molecular weight of 375.64 g/mol. Its IUPAC name is 5-chloro-4-[(2Z)-2-[(3,5-dichloro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[(2Z)-2-[(3,5-dichloro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 110509805 |
| Molecular Formula | C14H13Cl3N4O2 |
| Molecular Weight | 375.64 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 5-chloro-4-[(2Z)-2-[(3,5-dichloro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
| SMILES | CC(C)Oc1c(Cl)cc(/C=N\Nc2cn[nH]c(=O)c2Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl3N4O2/c1-7(2)23-13-9(15)3-8(4-10(13)16)5-18-20-11-6-19-21-14(22)12(11)17/h3-7H,1-2H3,(H2,20,21,22)/b18-5- |
| InChIKey | UFKFRPTXGUFGNV-DVZOWYKESA-N |
| XLogP | 3.96 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.64 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|