C11H7Cl3N4O2 — CID 135689804
5-chloro-4-[(2E)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one (PubChem CID 135689804) has the molecular formula C11H7Cl3N4O2 and a molecular weight of 333.56 g/mol. Its IUPAC name is 5-chloro-4-[(2E)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[(2E)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 135689804 |
| Molecular Formula | C11H7Cl3N4O2 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 331.96 |
| IUPAC Name | 5-chloro-4-[(2E)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(N/N=C/c2cc(Cl)cc(Cl)c2O)c1Cl |
| InChI | InChI=1S/C11H7Cl3N4O2/c12-6-1-5(10(19)7(13)2-6)3-15-17-8-4-16-18-11(20)9(8)14/h1-4,19H,(H2,17,18,20)/b15-3+ |
| InChIKey | NIPMLUYEDXFVEB-CRKCGEKBSA-N |
| XLogP | 2.88 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|