C12H10BrClN4O3 — CID 136926282
4-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-5-chloro-1H-pyridazin-6-one (PubChem CID 136926282) has the molecular formula C12H10BrClN4O3 and a molecular weight of 373.59 g/mol. Its IUPAC name is 4-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-5-chloro-1H-pyridazin-6-one.
| Compound Name | 4-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-5-chloro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 136926282 |
| Molecular Formula | C12H10BrClN4O3 |
| Molecular Weight | 373.59 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 4-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-5-chloro-1H-pyridazin-6-one |
| SMILES | COc1cc(Br)cc(/C=N\Nc2cn[nH]c(=O)c2Cl)c1O |
| InChI | InChI=1S/C12H10BrClN4O3/c1-21-9-3-7(13)2-6(11(9)19)4-15-17-8-5-16-18-12(20)10(8)14/h2-5,19H,1H3,(H2,17,18,20)/b15-4- |
| InChIKey | AJRIFTIEHYLQBR-TVPGTPATSA-N |
| XLogP | 2.35 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.59 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|