C11H7BrCl2N4O — CID 2792836
5-bromo-4-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one (PubChem CID 2792836) has the molecular formula C11H7BrCl2N4O and a molecular weight of 362.01 g/mol. Its IUPAC name is 5-bromo-4-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one.
| Compound Name | 5-bromo-4-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 2792836 |
| Molecular Formula | C11H7BrCl2N4O |
| Molecular Weight | 362.01 g/mol |
| Exact Mass | 359.92 |
| IUPAC Name | 5-bromo-4-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(NN=Cc2ccc(Cl)cc2Cl)c1Br |
| InChI | InChI=1S/C11H7BrCl2N4O/c12-10-9(5-16-18-11(10)19)17-15-4-6-1-2-7(13)3-8(6)14/h1-5H,(H2,17,18,19) |
| InChIKey | DVOLWDDHURRQRY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.01 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|