C19H16BrFN4O3 — CID 42558341
5-bromo-4-[(2Z)-2-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-1H-pyridazin-6-one (PubChem CID 42558341) has the molecular formula C19H16BrFN4O3 and a molecular weight of 447.26 g/mol. Its IUPAC name is 5-bromo-4-[(2Z)-2-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-1H-pyridazin-6-one.
| Compound Name | 5-bromo-4-[(2Z)-2-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 42558341 |
| Molecular Formula | C19H16BrFN4O3 |
| Molecular Weight | 447.26 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 5-bromo-4-[(2Z)-2-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-1H-pyridazin-6-one |
| SMILES | COc1cccc(/C=N\Nc2cn[nH]c(=O)c2Br)c1OCc1ccccc1F |
| InChI | InChI=1S/C19H16BrFN4O3/c1-27-16-8-4-6-12(9-22-24-15-10-23-25-19(26)17(15)20)18(16)28-11-13-5-2-3-7-14(13)21/h2-10H,11H2,1H3,(H2,24,25,26)/b22-9- |
| InChIKey | WLHJGURTDBPYPM-AFPJDJCSSA-N |
| XLogP | 3.71 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|