C18H15FN4O3S — CID 110339245
4-[(E)-[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 110339245) has the molecular formula C18H15FN4O3S and a molecular weight of 386.41 g/mol. Its IUPAC name is 4-[(E)-[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 4-[(E)-[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 110339245 |
| Molecular Formula | C18H15FN4O3S |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 4-[(E)-[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | COc1cccc(/C=N/n2c(=O)cn[nH]c2=S)c1OCc1ccccc1F |
| InChI | InChI=1S/C18H15FN4O3S/c1-25-15-8-4-6-12(9-21-23-16(24)10-20-22-18(23)27)17(15)26-11-13-5-2-3-7-14(13)19/h2-10H,11H2,1H3,(H,22,27)/b21-9+ |
| InChIKey | WNVBAHQYCZNIRO-ZVBGSRNCSA-N |
| XLogP | 2.91 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|