C12H11BrN4O3S — CID 110508055
4-[(Z)-(2-bromo-3,4-dimethoxyphenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 110508055) has the molecular formula C12H11BrN4O3S and a molecular weight of 371.22 g/mol. Its IUPAC name is 4-[(Z)-(2-bromo-3,4-dimethoxyphenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 4-[(Z)-(2-bromo-3,4-dimethoxyphenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 110508055 |
| Molecular Formula | C12H11BrN4O3S |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | 4-[(Z)-(2-bromo-3,4-dimethoxyphenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | COc1ccc(/C=N\n2c(=O)cn[nH]c2=S)c(Br)c1OC |
| InChI | InChI=1S/C12H11BrN4O3S/c1-19-8-4-3-7(10(13)11(8)20-2)5-15-17-9(18)6-14-16-12(17)21/h3-6H,1-2H3,(H,16,21)/b15-5- |
| InChIKey | SLDMLCGQTVVAJX-WCSRMQSCSA-N |
| XLogP | 1.96 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|