C11H9N5O5S — CID 110341510
4-[(E)-(5-hydroxy-4-methoxy-2-nitrophenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 110341510) has the molecular formula C11H9N5O5S and a molecular weight of 323.29 g/mol. Its IUPAC name is 4-[(E)-(5-hydroxy-4-methoxy-2-nitrophenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 4-[(E)-(5-hydroxy-4-methoxy-2-nitrophenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 110341510 |
| Molecular Formula | C11H9N5O5S |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 4-[(E)-(5-hydroxy-4-methoxy-2-nitrophenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | COc1cc([N+](=O)[O-])c(/C=N/n2c(=O)cn[nH]c2=S)cc1O |
| InChI | InChI=1S/C11H9N5O5S/c1-21-9-3-7(16(19)20)6(2-8(9)17)4-13-15-10(18)5-12-14-11(15)22/h2-5,17H,1H3,(H,14,22)/b13-4+ |
| InChIKey | ANPDIGHYUCSVEO-YIXHJXPBSA-N |
| XLogP | 0.81 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|