C17H17N7O4S2 — CID 25267530
4-[(E)-(4,5-dimethoxy-2-nitrophenyl)methylideneamino]-3-[(4-methylpyrimidin-2-yl)sulfanylmethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 25267530) has the molecular formula C17H17N7O4S2 and a molecular weight of 447.50 g/mol. Its IUPAC name is 4-[(E)-(4,5-dimethoxy-2-nitrophenyl)methylideneamino]-3-[(4-methylpyrimidin-2-yl)sulfanylmethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(4,5-dimethoxy-2-nitrophenyl)methylideneamino]-3-[(4-methylpyrimidin-2-yl)sulfanylmethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 25267530 |
| Molecular Formula | C17H17N7O4S2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 4-[(E)-(4,5-dimethoxy-2-nitrophenyl)methylideneamino]-3-[(4-methylpyrimidin-2-yl)sulfanylmethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(/C=N/n2c(CSc3nccc(C)n3)n[nH]c2=S)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H17N7O4S2/c1-10-4-5-18-16(20-10)30-9-15-21-22-17(29)23(15)19-8-11-6-13(27-2)14(28-3)7-12(11)24(25)26/h4-8H,9H2,1-3H3,(H,22,29)/b19-8+ |
| InChIKey | XOHFALIIOKKJCL-UFWORHAWSA-N |
| XLogP | 3.14 |
| TPSA | 133.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|