C20H21N5O4S — CID 110520213
3-benzyl-4-[(Z)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 110520213) has the molecular formula C20H21N5O4S and a molecular weight of 427.49 g/mol. Its IUPAC name is 3-benzyl-4-[(Z)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-benzyl-4-[(Z)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110520213 |
| Molecular Formula | C20H21N5O4S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 3-benzyl-4-[(Z)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(OCC)c([N+](=O)[O-])cc1/C=N\n1c(Cc2ccccc2)n[nH]c1=S |
| InChI | InChI=1S/C20H21N5O4S/c1-3-28-17-12-18(29-4-2)16(25(26)27)11-15(17)13-21-24-19(22-23-20(24)30)10-14-8-6-5-7-9-14/h5-9,11-13H,3-4,10H2,1-2H3,(H,23,30)/b21-13- |
| InChIKey | SJEOKISNWMPTMB-BKUYFWCQSA-N |
| XLogP | 4.12 |
| TPSA | 107.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|