C18H16FN5O3S — CID 110521005
4-[(Z)-(4-ethoxy-3-nitrophenyl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 110521005) has the molecular formula C18H16FN5O3S and a molecular weight of 401.42 g/mol. Its IUPAC name is 4-[(Z)-(4-ethoxy-3-nitrophenyl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(4-ethoxy-3-nitrophenyl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110521005 |
| Molecular Formula | C18H16FN5O3S |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 4-[(Z)-(4-ethoxy-3-nitrophenyl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1ccc(/C=N\n2c(Cc3ccc(F)cc3)n[nH]c2=S)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16FN5O3S/c1-2-27-16-8-5-13(9-15(16)24(25)26)11-20-23-17(21-22-18(23)28)10-12-3-6-14(19)7-4-12/h3-9,11H,2,10H2,1H3,(H,22,28)/b20-11- |
| InChIKey | XLUOXLZHDUJHOU-JAIQZWGSSA-N |
| XLogP | 3.86 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|