C18H16FN5O4S — CID 110521026
4-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 110521026) has the molecular formula C18H16FN5O4S and a molecular weight of 417.42 g/mol. Its IUPAC name is 4-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110521026 |
| Molecular Formula | C18H16FN5O4S |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 4-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1/C=N\n1c(Cc2ccc(F)cc2)n[nH]c1=S |
| InChI | InChI=1S/C18H16FN5O4S/c1-27-15-9-16(28-2)14(24(25)26)8-12(15)10-20-23-17(21-22-18(23)29)7-11-3-5-13(19)6-4-11/h3-6,8-10H,7H2,1-2H3,(H,22,29)/b20-10- |
| InChIKey | JBLOWQIBTFCJBN-JMIUGGIZSA-N |
| XLogP | 3.48 |
| TPSA | 107.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|