C18H17FN4S — CID 9181863
4-[(Z)-(2,4-dimethylphenyl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 9181863) has the molecular formula C18H17FN4S and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-[(Z)-(2,4-dimethylphenyl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(2,4-dimethylphenyl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9181863 |
| Molecular Formula | C18H17FN4S |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-[(Z)-(2,4-dimethylphenyl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(/C=N\n2c(Cc3ccc(F)cc3)n[nH]c2=S)c(C)c1 |
| InChI | InChI=1S/C18H17FN4S/c1-12-3-6-15(13(2)9-12)11-20-23-17(21-22-18(23)24)10-14-4-7-16(19)8-5-14/h3-9,11H,10H2,1-2H3,(H,22,24)/b20-11- |
| InChIKey | JMTLFBDJUMDXPK-JAIQZWGSSA-N |
| XLogP | 4.17 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|