C16H16FN5S — CID 135812172
4-[(E)-(2,5-dimethyl-1H-pyrrol-3-yl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 135812172) has the molecular formula C16H16FN5S and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-[(E)-(2,5-dimethyl-1H-pyrrol-3-yl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(2,5-dimethyl-1H-pyrrol-3-yl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135812172 |
| Molecular Formula | C16H16FN5S |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 4-[(E)-(2,5-dimethyl-1H-pyrrol-3-yl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(/C=N/n2c(Cc3ccc(F)cc3)n[nH]c2=S)c(C)[nH]1 |
| InChI | InChI=1S/C16H16FN5S/c1-10-7-13(11(2)19-10)9-18-22-15(20-21-16(22)23)8-12-3-5-14(17)6-4-12/h3-7,9,19H,8H2,1-2H3,(H,21,23)/b18-9+ |
| InChIKey | GQRJHTKDJWFTBY-GIJQJNRQSA-N |
| XLogP | 3.50 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|