C21H19FN6S — CID 9182137
4-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 9182137) has the molecular formula C21H19FN6S and a molecular weight of 406.49 g/mol. Its IUPAC name is 4-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9182137 |
| Molecular Formula | C21H19FN6S |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-3-[(4-fluorophenyl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=N\n1c(Cc2ccc(F)cc2)n[nH]c1=S |
| InChI | InChI=1S/C21H19FN6S/c1-14-19(15(2)27(26-14)18-6-4-3-5-7-18)13-23-28-20(24-25-21(28)29)12-16-8-10-17(22)11-9-16/h3-11,13H,12H2,1-2H3,(H,25,29)/b23-13+ |
| InChIKey | XGGOQPQFCBWTFU-YDZHTSKRSA-N |
| XLogP | 4.36 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|