C20H16Cl2N6S — CID 2145375
3-(2,4-dichlorophenyl)-4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 2145375) has the molecular formula C20H16Cl2N6S and a molecular weight of 443.36 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2,4-dichlorophenyl)-4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 2145375 |
| Molecular Formula | C20H16Cl2N6S |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C=Nn1c(-c2ccc(Cl)cc2Cl)n[nH]c1=S |
| InChI | InChI=1S/C20H16Cl2N6S/c1-12-17(13(2)27(26-12)15-6-4-3-5-7-15)11-23-28-19(24-25-20(28)29)16-9-8-14(21)10-18(16)22/h3-11H,1-2H3,(H,25,29) |
| InChIKey | PRKCVHTUMSBLLS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|