C17H13Cl2N5OS — CID 9174645
N-[4-[(Z)-[3-(2,4-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenyl]acetamide (PubChem CID 9174645) has the molecular formula C17H13Cl2N5OS and a molecular weight of 406.30 g/mol. Its IUPAC name is N-[4-[(Z)-[3-(2,4-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenyl]acetamide.
| Compound Name | N-[4-[(Z)-[3-(2,4-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 9174645 |
| Molecular Formula | C17H13Cl2N5OS |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | N-[4-[(Z)-[3-(2,4-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=N\n2c(-c3ccc(Cl)cc3Cl)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C17H13Cl2N5OS/c1-10(25)21-13-5-2-11(3-6-13)9-20-24-16(22-23-17(24)26)14-7-4-12(18)8-15(14)19/h2-9H,1H3,(H,21,25)(H,23,26)/b20-9- |
| InChIKey | YWDYHAISELZSDZ-UKWGHVSLSA-N |
| XLogP | 4.76 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|