C17H12Cl2N4O3S — CID 1347025
2-[2-[[3-(2,4-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetic acid (PubChem CID 1347025) has the molecular formula C17H12Cl2N4O3S and a molecular weight of 423.28 g/mol. Its IUPAC name is 2-[2-[[3-(2,4-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[3-(2,4-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 1347025 |
| Molecular Formula | C17H12Cl2N4O3S |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | 2-[2-[[3-(2,4-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1C=Nn1c(-c2ccc(Cl)cc2Cl)n[nH]c1=S |
| InChI | InChI=1S/C17H12Cl2N4O3S/c18-11-5-6-12(13(19)7-11)16-21-22-17(27)23(16)20-8-10-3-1-2-4-14(10)26-9-15(24)25/h1-8H,9H2,(H,22,27)(H,24,25) |
| InChIKey | OBSFERPPJRRDHN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|