C17H15ClN4O2S — CID 135838525
4-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-(2-ethoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 135838525) has the molecular formula C17H15ClN4O2S and a molecular weight of 374.85 g/mol. Its IUPAC name is 4-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-(2-ethoxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-(2-ethoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135838525 |
| Molecular Formula | C17H15ClN4O2S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 4-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-(2-ethoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1ccccc1-c1n[nH]c(=S)n1/N=C/c1cc(Cl)ccc1O |
| InChI | InChI=1S/C17H15ClN4O2S/c1-2-24-15-6-4-3-5-13(15)16-20-21-17(25)22(16)19-10-11-9-12(18)7-8-14(11)23/h3-10,23H,2H2,1H3,(H,21,25)/b19-10+ |
| InChIKey | KPAXGIKBUAGCIX-VXLYETTFSA-N |
| XLogP | 4.25 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|