C17H15N5O5S — CID 136873963
4-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-3-(2-ethoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 136873963) has the molecular formula C17H15N5O5S and a molecular weight of 401.40 g/mol. Its IUPAC name is 4-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-3-(2-ethoxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-3-(2-ethoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136873963 |
| Molecular Formula | C17H15N5O5S |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 4-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-3-(2-ethoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1ccccc1-c1n[nH]c(=S)n1/N=C\c1cc([N+](=O)[O-])c(O)cc1O |
| InChI | InChI=1S/C17H15N5O5S/c1-2-27-15-6-4-3-5-11(15)16-19-20-17(28)21(16)18-9-10-7-12(22(25)26)14(24)8-13(10)23/h3-9,23-24H,2H2,1H3,(H,20,28)/b18-9- |
| InChIKey | XPPYMTHSSMOCEC-NVMNQCDNSA-N |
| XLogP | 3.21 |
| TPSA | 138.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|