C17H12FN4O3S- — CID 6889541
2-[2-[(E)-[3-(2-fluorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetate (PubChem CID 6889541) has the molecular formula C17H12FN4O3S- and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-[2-[(E)-[3-(2-fluorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetate.
| Compound Name | 2-[2-[(E)-[3-(2-fluorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 6889541 |
| Molecular Formula | C17H12FN4O3S- |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-[2-[(E)-[3-(2-fluorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccccc1/C=N/n1c(-c2ccccc2F)n[nH]c1=S |
| InChI | InChI=1S/C17H13FN4O3S/c18-13-7-3-2-6-12(13)16-20-21-17(26)22(16)19-9-11-5-1-4-8-14(11)25-10-15(23)24/h1-9H,10H2,(H,21,26)(H,23,24)/p-1/b19-9+ |
| InChIKey | YKJHUYOIBGTUEO-DJKKODMXSA-M |
| XLogP | 1.76 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|