C15H11FN4O2S — CID 135811449
4-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-3-(2-fluorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 135811449) has the molecular formula C15H11FN4O2S and a molecular weight of 330.34 g/mol. Its IUPAC name is 4-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-3-(2-fluorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-3-(2-fluorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135811449 |
| Molecular Formula | C15H11FN4O2S |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 4-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-3-(2-fluorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Oc1cccc(/C=N/n2c(-c3ccccc3F)n[nH]c2=S)c1O |
| InChI | InChI=1S/C15H11FN4O2S/c16-11-6-2-1-5-10(11)14-18-19-15(23)20(14)17-8-9-4-3-7-12(21)13(9)22/h1-8,21-22H,(H,19,23)/b17-8+ |
| InChIKey | VDRXHJRGJVNFDT-CAOOACKPSA-N |
| XLogP | 3.04 |
| TPSA | 86.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|