C18H18FN5O2S — CID 135710539
ethyl 5-[(E)-[3-(2-fluorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 135710539) has the molecular formula C18H18FN5O2S and a molecular weight of 387.44 g/mol. Its IUPAC name is ethyl 5-[(E)-[3-(2-fluorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[(E)-[3-(2-fluorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 135710539 |
| Molecular Formula | C18H18FN5O2S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | ethyl 5-[(E)-[3-(2-fluorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(/C=N/n2c(-c3ccccc3F)n[nH]c2=S)c1C |
| InChI | InChI=1S/C18H18FN5O2S/c1-4-26-17(25)15-10(2)14(21-11(15)3)9-20-24-16(22-23-18(24)27)12-7-5-6-8-13(12)19/h5-9,21H,4H2,1-3H3,(H,23,27)/b20-9+ |
| InChIKey | WMOIWBAYZCUJHF-AWQFTUOYSA-N |
| XLogP | 3.75 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|