C18H17Cl2N5S — CID 55353106
4-[(E)-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 55353106) has the molecular formula C18H17Cl2N5S and a molecular weight of 406.34 g/mol. Its IUPAC name is 4-[(E)-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 55353106 |
| Molecular Formula | C18H17Cl2N5S |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 4-[(E)-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(/C=N/n2c(-c3ccc(Cl)cc3Cl)n[nH]c2=S)c(C)n1C1CC1 |
| InChI | InChI=1S/C18H17Cl2N5S/c1-10-7-12(11(2)24(10)14-4-5-14)9-21-25-17(22-23-18(25)26)15-6-3-13(19)8-16(15)20/h3,6-9,14H,4-5H2,1-2H3,(H,23,26)/b21-9+ |
| InChIKey | OBDKWKCOGBFPBB-ZVBGSRNCSA-N |
| XLogP | 5.55 |
| TPSA | 50.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|